C23H22FN3O4 — CID 86897726
methyl 5-[[4-(4-fluorophenyl)oxan-4-yl]carbamoyl]-1-phenylpyrazole-3-carboxylate (PubChem CID 86897726) has the molecular formula C23H22FN3O4 and a molecular weight of 423.44 g/mol. Its IUPAC name is methyl 5-[[4-(4-fluorophenyl)oxan-4-yl]carbamoyl]-1-phenylpyrazole-3-carboxylate.
| Compound Name | methyl 5-[[4-(4-fluorophenyl)oxan-4-yl]carbamoyl]-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 86897726 |
| Molecular Formula | C23H22FN3O4 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | methyl 5-[[4-(4-fluorophenyl)oxan-4-yl]carbamoyl]-1-phenylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(C(=O)NC2(c3ccc(F)cc3)CCOCC2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H22FN3O4/c1-30-22(29)19-15-20(27(26-19)18-5-3-2-4-6-18)21(28)25-23(11-13-31-14-12-23)16-7-9-17(24)10-8-16/h2-10,15H,11-14H2,1H3,(H,25,28) |
| InChIKey | WLZNRHGXDCWDBL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |