C15H13N5O6 — CID 3326846
N-methyl-N'-(4-methylphenyl)-N-(2,4,6-trinitrophenyl)methanimidamide (PubChem CID 3326846) has the molecular formula C15H13N5O6 and a molecular weight of 359.30 g/mol. Its IUPAC name is N-methyl-N'-(4-methylphenyl)-N-(2,4,6-trinitrophenyl)methanimidamide.
| Compound Name | N-methyl-N'-(4-methylphenyl)-N-(2,4,6-trinitrophenyl)methanimidamide |
|---|---|
| PubChem CID | 3326846 |
| Molecular Formula | C15H13N5O6 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-methyl-N'-(4-methylphenyl)-N-(2,4,6-trinitrophenyl)methanimidamide |
| SMILES | Cc1ccc(/N=C/N(C)c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H13N5O6/c1-10-3-5-11(6-4-10)16-9-17(2)15-13(19(23)24)7-12(18(21)22)8-14(15)20(25)26/h3-9H,1-2H3/b16-9+ |
| InChIKey | JKNHMDPARRSKQE-CXUHLZMHSA-N |
| XLogP | 3.52 |
| TPSA | 145.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|