C19H12Br2N4O4S — CID 3368909
N,N'-bis(4-bromophenyl)-N-(2,4-dinitrophenyl)sulfanylmethanimidamide (PubChem CID 3368909) has the molecular formula C19H12Br2N4O4S and a molecular weight of 552.20 g/mol. Its IUPAC name is N,N'-bis(4-bromophenyl)-N-(2,4-dinitrophenyl)sulfanylmethanimidamide.
| Compound Name | N,N'-bis(4-bromophenyl)-N-(2,4-dinitrophenyl)sulfanylmethanimidamide |
|---|---|
| PubChem CID | 3368909 |
| Molecular Formula | C19H12Br2N4O4S |
| Molecular Weight | 552.20 g/mol |
| Exact Mass | 549.89 |
| IUPAC Name | N,N'-bis(4-bromophenyl)-N-(2,4-dinitrophenyl)sulfanylmethanimidamide |
| SMILES | O=[N+]([O-])c1ccc(SN(/C=N/c2ccc(Br)cc2)c2ccc(Br)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12Br2N4O4S/c20-13-1-5-15(6-2-13)22-12-23(16-7-3-14(21)4-8-16)30-19-10-9-17(24(26)27)11-18(19)25(28)29/h1-12H/b22-12+ |
| InChIKey | OGEOBOYMQTZLBQ-WSDLNYQXSA-N |
| XLogP | 6.90 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.20 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|