C21H17N5O7 — CID 2317924
1-hydroxy-N,2-bis(4-methoxyphenyl)-4,6-dinitroindazol-3-imine (PubChem CID 2317924) has the molecular formula C21H17N5O7 and a molecular weight of 451.40 g/mol. Its IUPAC name is 1-hydroxy-N,2-bis(4-methoxyphenyl)-4,6-dinitroindazol-3-imine.
| Compound Name | 1-hydroxy-N,2-bis(4-methoxyphenyl)-4,6-dinitroindazol-3-imine |
|---|---|
| PubChem CID | 2317924 |
| Molecular Formula | C21H17N5O7 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 1-hydroxy-N,2-bis(4-methoxyphenyl)-4,6-dinitroindazol-3-imine |
| SMILES | COc1ccc(/N=c2/c3c([N+](=O)[O-])cc([N+](=O)[O-])cc3n(O)n2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H17N5O7/c1-32-16-7-3-13(4-8-16)22-21-20-18(11-15(25(28)29)12-19(20)26(30)31)24(27)23(21)14-5-9-17(33-2)10-6-14/h3-12,27H,1-2H3/b22-21- |
| InChIKey | KFLJKARWMRAUKT-DQRAZIAOSA-N |
| XLogP | 3.74 |
| TPSA | 147.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|