C22H21N5O7 — CID 21179214
1-hydroxy-2-(4-methoxyphenyl)-N-(4-methylphenyl)-4,6-dinitroindazol-3-imine;methanol (PubChem CID 21179214) has the molecular formula C22H21N5O7 and a molecular weight of 467.44 g/mol. Its IUPAC name is 1-hydroxy-2-(4-methoxyphenyl)-N-(4-methylphenyl)-4,6-dinitroindazol-3-imine;methanol.
| Compound Name | 1-hydroxy-2-(4-methoxyphenyl)-N-(4-methylphenyl)-4,6-dinitroindazol-3-imine;methanol |
|---|---|
| PubChem CID | 21179214 |
| Molecular Formula | C22H21N5O7 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 1-hydroxy-2-(4-methoxyphenyl)-N-(4-methylphenyl)-4,6-dinitroindazol-3-imine;methanol |
| SMILES | CO.COc1ccc(-n2/c(=N\c3ccc(C)cc3)c3c([N+](=O)[O-])cc([N+](=O)[O-])cc3n2O)cc1 |
| InChI | InChI=1S/C21H17N5O6.CH4O/c1-13-3-5-14(6-4-13)22-21-20-18(11-16(25(28)29)12-19(20)26(30)31)24(27)23(21)15-7-9-17(32-2)10-8-15;1-2/h3-12,27H,1-2H3;2H,1H3/b22-21-; |
| InChIKey | NXUQGCCCJYUQOE-SVXKRPBISA-N |
| XLogP | 3.64 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|