C27H22N4O5S — CID 4653810
N-(2,4-dinitrophenyl)sulfanyl-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide (PubChem CID 4653810) has the molecular formula C27H22N4O5S and a molecular weight of 514.56 g/mol. Its IUPAC name is N-(2,4-dinitrophenyl)sulfanyl-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide.
| Compound Name | N-(2,4-dinitrophenyl)sulfanyl-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 4653810 |
| Molecular Formula | C27H22N4O5S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | N-(2,4-dinitrophenyl)sulfanyl-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide |
| SMILES | COc1ccc(N(Sc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])/C(=N/c2ccc(C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H22N4O5S/c1-19-8-10-21(11-9-19)28-27(20-6-4-3-5-7-20)29(22-12-15-24(36-2)16-13-22)37-26-17-14-23(30(32)33)18-25(26)31(34)35/h3-18H,1-2H3/b28-27+ |
| InChIKey | CZYAAHYYAVZRCI-BYYHNAKLSA-N |
| XLogP | 7.11 |
| TPSA | 111.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|