C28H25N3O6S — CID 4863289
N,N'-bis(4-methoxyphenyl)-4-methyl-N-(2-nitrophenyl)sulfonylbenzenecarboximidamide (PubChem CID 4863289) has the molecular formula C28H25N3O6S and a molecular weight of 531.59 g/mol. Its IUPAC name is N,N'-bis(4-methoxyphenyl)-4-methyl-N-(2-nitrophenyl)sulfonylbenzenecarboximidamide.
| Compound Name | N,N'-bis(4-methoxyphenyl)-4-methyl-N-(2-nitrophenyl)sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 4863289 |
| Molecular Formula | C28H25N3O6S |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | N,N'-bis(4-methoxyphenyl)-4-methyl-N-(2-nitrophenyl)sulfonylbenzenecarboximidamide |
| SMILES | COc1ccc(/N=C(\c2ccc(C)cc2)N(c2ccc(OC)cc2)S(=O)(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H25N3O6S/c1-20-8-10-21(11-9-20)28(29-22-12-16-24(36-2)17-13-22)30(23-14-18-25(37-3)19-15-23)38(34,35)27-7-5-4-6-26(27)31(32)33/h4-19H,1-3H3/b29-28+ |
| InChIKey | PTYVHIBGXSPKGP-ZQHSETAFSA-N |
| XLogP | 5.89 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|