C23H17N3O3S — CID 46855990
1-(4-methoxyphenyl)-2-(4-methylphenyl)-7-nitroimidazo[2,1-b][1,3]benzothiazole (PubChem CID 46855990) has the molecular formula C23H17N3O3S and a molecular weight of 415.47 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-(4-methylphenyl)-7-nitroimidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 1-(4-methoxyphenyl)-2-(4-methylphenyl)-7-nitroimidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 46855990 |
| Molecular Formula | C23H17N3O3S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-(4-methylphenyl)-7-nitroimidazo[2,1-b][1,3]benzothiazole |
| SMILES | COc1ccc(-c2c(-c3ccc(C)cc3)nc3sc4ccc([N+](=O)[O-])cc4n23)cc1 |
| InChI | InChI=1S/C23H17N3O3S/c1-14-3-5-15(6-4-14)21-22(16-7-10-18(29-2)11-8-16)25-19-13-17(26(27)28)9-12-20(19)30-23(25)24-21/h3-13H,1-2H3 |
| InChIKey | MFOGZZFLXWDYPR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|