C7H2F3N4O4+ — CID 56974236
2,4-dinitro-6-(trifluoromethyl)benzenediazonium (PubChem CID 56974236) has the molecular formula C7H2F3N4O4+ and a molecular weight of 263.11 g/mol. Its IUPAC name is 2,4-dinitro-6-(trifluoromethyl)benzenediazonium.
| Compound Name | 2,4-dinitro-6-(trifluoromethyl)benzenediazonium |
|---|---|
| PubChem CID | 56974236 |
| Molecular Formula | C7H2F3N4O4+ |
| Molecular Weight | 263.11 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 2,4-dinitro-6-(trifluoromethyl)benzenediazonium |
| SMILES | N#[N+]c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C7H2F3N4O4/c8-7(9,10)4-1-3(13(15)16)2-5(14(17)18)6(4)12-11/h1-2H/q+1 |
| InChIKey | OYXLXGJLFMYQJQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.11 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|