C13H14F4N2O4 — CID 173451460
1-tert-butyl-3,5-dinitro-2-(1,1,2,2-tetrafluoropropyl)benzene (PubChem CID 173451460) has the molecular formula C13H14F4N2O4 and a molecular weight of 338.26 g/mol. Its IUPAC name is 1-tert-butyl-3,5-dinitro-2-(1,1,2,2-tetrafluoropropyl)benzene.
| Compound Name | 1-tert-butyl-3,5-dinitro-2-(1,1,2,2-tetrafluoropropyl)benzene |
|---|---|
| PubChem CID | 173451460 |
| Molecular Formula | C13H14F4N2O4 |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-tert-butyl-3,5-dinitro-2-(1,1,2,2-tetrafluoropropyl)benzene |
| SMILES | CC(C)(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C13H14F4N2O4/c1-11(2,3)8-5-7(18(20)21)6-9(19(22)23)10(8)13(16,17)12(4,14)15/h5-6H,1-4H3 |
| InChIKey | FBUQVKAXBFXNTI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|