C9H10BrNO5S — CID 171892506
4-(4-bromo-1,2-dihydroxybutyl)-5-nitrothiophene-2-carbaldehyde (PubChem CID 171892506) has the molecular formula C9H10BrNO5S and a molecular weight of 324.15 g/mol. Its IUPAC name is 4-(4-bromo-1,2-dihydroxybutyl)-5-nitrothiophene-2-carbaldehyde.
| Compound Name | 4-(4-bromo-1,2-dihydroxybutyl)-5-nitrothiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 171892506 |
| Molecular Formula | C9H10BrNO5S |
| Molecular Weight | 324.15 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | 4-(4-bromo-1,2-dihydroxybutyl)-5-nitrothiophene-2-carbaldehyde |
| SMILES | O=Cc1cc(C(O)C(O)CCBr)c([N+](=O)[O-])s1 |
| InChI | InChI=1S/C9H10BrNO5S/c10-2-1-7(13)8(14)6-3-5(4-12)17-9(6)11(15)16/h3-4,7-8,13-14H,1-2H2 |
| InChIKey | NHCXBUQWRDKPOI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.15 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|