C9H11BrO4 — CID 171891436
3-(4-bromo-1,2-dihydroxybutyl)furan-2-carbaldehyde (PubChem CID 171891436) has the molecular formula C9H11BrO4 and a molecular weight of 263.09 g/mol. Its IUPAC name is 3-(4-bromo-1,2-dihydroxybutyl)furan-2-carbaldehyde.
| Compound Name | 3-(4-bromo-1,2-dihydroxybutyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 171891436 |
| Molecular Formula | C9H11BrO4 |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 3-(4-bromo-1,2-dihydroxybutyl)furan-2-carbaldehyde |
| SMILES | O=Cc1occc1C(O)C(O)CCBr |
| InChI | InChI=1S/C9H11BrO4/c10-3-1-7(12)9(13)6-2-4-14-8(6)5-11/h2,4-5,7,9,12-13H,1,3H2 |
| InChIKey | SIXTYFNJSLBGOU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|