C8H10O4 — CID 150623076
3-(2,3-dihydroxypropyl)furan-2-carbaldehyde (PubChem CID 150623076) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropyl)furan-2-carbaldehyde.
| Compound Name | 3-(2,3-dihydroxypropyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 150623076 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 3-(2,3-dihydroxypropyl)furan-2-carbaldehyde |
| SMILES | O=Cc1occc1CC(O)CO |
| InChI | InChI=1S/C8H10O4/c9-4-7(11)3-6-1-2-12-8(6)5-10/h1-2,5,7,9,11H,3-4H2 |
| InChIKey | IWHYKCWSVOKODT-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|