C10H13NO3 — CID 163691147
2-(2,3-dihydroxypropyl)benzamide (PubChem CID 163691147) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropyl)benzamide.
| Compound Name | 2-(2,3-dihydroxypropyl)benzamide |
|---|---|
| PubChem CID | 163691147 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2-(2,3-dihydroxypropyl)benzamide |
| SMILES | NC(=O)c1ccccc1CC(O)CO |
| InChI | InChI=1S/C10H13NO3/c11-10(14)9-4-2-1-3-7(9)5-8(13)6-12/h1-4,8,12-13H,5-6H2,(H2,11,14) |
| InChIKey | JTBFCNMYPWDGPT-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |