C10H13FN2O4 — CID 171858387
1-(3-fluoro-2-nitrophenyl)-3-(methylamino)propane-1,2-diol (PubChem CID 171858387) has the molecular formula C10H13FN2O4 and a molecular weight of 244.22 g/mol. Its IUPAC name is 1-(3-fluoro-2-nitrophenyl)-3-(methylamino)propane-1,2-diol.
| Compound Name | 1-(3-fluoro-2-nitrophenyl)-3-(methylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 171858387 |
| Molecular Formula | C10H13FN2O4 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-(3-fluoro-2-nitrophenyl)-3-(methylamino)propane-1,2-diol |
| SMILES | CNCC(O)C(O)c1cccc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13FN2O4/c1-12-5-8(14)10(15)6-3-2-4-7(11)9(6)13(16)17/h2-4,8,10,12,14-15H,5H2,1H3 |
| InChIKey | XUCLTJQWFKCIRF-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|