C10H10F4N2O5 — CID 168593945
3-[3-fluoro-4-nitro-2-(trifluoromethoxy)anilino]propane-1,2-diol (PubChem CID 168593945) has the molecular formula C10H10F4N2O5 and a molecular weight of 314.19 g/mol. Its IUPAC name is 3-[3-fluoro-4-nitro-2-(trifluoromethoxy)anilino]propane-1,2-diol.
| Compound Name | 3-[3-fluoro-4-nitro-2-(trifluoromethoxy)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168593945 |
| Molecular Formula | C10H10F4N2O5 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-[3-fluoro-4-nitro-2-(trifluoromethoxy)anilino]propane-1,2-diol |
| SMILES | O=[N+]([O-])c1ccc(NCC(O)CO)c(OC(F)(F)F)c1F |
| InChI | InChI=1S/C10H10F4N2O5/c11-8-7(16(19)20)2-1-6(15-3-5(18)4-17)9(8)21-10(12,13)14/h1-2,5,15,17-18H,3-4H2 |
| InChIKey | QLLRWGXKSXQBCQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|