C9H9ClF2N2O3 — CID 168640845
1-chloro-3-(4,5-difluoro-2-nitroanilino)propan-2-ol (PubChem CID 168640845) has the molecular formula C9H9ClF2N2O3 and a molecular weight of 266.63 g/mol. Its IUPAC name is 1-chloro-3-(4,5-difluoro-2-nitroanilino)propan-2-ol.
| Compound Name | 1-chloro-3-(4,5-difluoro-2-nitroanilino)propan-2-ol |
|---|---|
| PubChem CID | 168640845 |
| Molecular Formula | C9H9ClF2N2O3 |
| Molecular Weight | 266.63 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 1-chloro-3-(4,5-difluoro-2-nitroanilino)propan-2-ol |
| SMILES | O=[N+]([O-])c1cc(F)c(F)cc1NCC(O)CCl |
| InChI | InChI=1S/C9H9ClF2N2O3/c10-3-5(15)4-13-8-1-6(11)7(12)2-9(8)14(16)17/h1-2,5,13,15H,3-4H2 |
| InChIKey | XQOOSOXZWWHIFY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.63 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|