C10H12ClN3O5 — CID 168638095
1-chloro-3-(4-methyl-3,5-dinitroanilino)propan-2-ol (PubChem CID 168638095) has the molecular formula C10H12ClN3O5 and a molecular weight of 289.68 g/mol. Its IUPAC name is 1-chloro-3-(4-methyl-3,5-dinitroanilino)propan-2-ol.
| Compound Name | 1-chloro-3-(4-methyl-3,5-dinitroanilino)propan-2-ol |
|---|---|
| PubChem CID | 168638095 |
| Molecular Formula | C10H12ClN3O5 |
| Molecular Weight | 289.68 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 1-chloro-3-(4-methyl-3,5-dinitroanilino)propan-2-ol |
| SMILES | Cc1c([N+](=O)[O-])cc(NCC(O)CCl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12ClN3O5/c1-6-9(13(16)17)2-7(3-10(6)14(18)19)12-5-8(15)4-11/h2-3,8,12,15H,4-5H2,1H3 |
| InChIKey | FKPKWOAJKTWCPD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.68 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|