C8H9N3O7 — CID 19042665
2-(4-hydroxy-3,5-dinitroanilino)ethane-1,1-diol (PubChem CID 19042665) has the molecular formula C8H9N3O7 and a molecular weight of 259.17 g/mol. Its IUPAC name is 2-(4-hydroxy-3,5-dinitroanilino)ethane-1,1-diol.
| Compound Name | 2-(4-hydroxy-3,5-dinitroanilino)ethane-1,1-diol |
|---|---|
| PubChem CID | 19042665 |
| Molecular Formula | C8H9N3O7 |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-(4-hydroxy-3,5-dinitroanilino)ethane-1,1-diol |
| SMILES | O=[N+]([O-])c1cc(NCC(O)O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C8H9N3O7/c12-7(13)3-9-4-1-5(10(15)16)8(14)6(2-4)11(17)18/h1-2,7,9,12-14H,3H2 |
| InChIKey | HGURCVBELYEBBL-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 159.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|