C11H13F2NO4 — CID 168595696
2-[4-(2,3-dihydroxypropylamino)-2,3-difluorophenyl]acetic acid (PubChem CID 168595696) has the molecular formula C11H13F2NO4 and a molecular weight of 261.22 g/mol. Its IUPAC name is 2-[4-(2,3-dihydroxypropylamino)-2,3-difluorophenyl]acetic acid.
| Compound Name | 2-[4-(2,3-dihydroxypropylamino)-2,3-difluorophenyl]acetic acid |
|---|---|
| PubChem CID | 168595696 |
| Molecular Formula | C11H13F2NO4 |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-[4-(2,3-dihydroxypropylamino)-2,3-difluorophenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NCC(O)CO)c(F)c1F |
| InChI | InChI=1S/C11H13F2NO4/c12-10-6(3-9(17)18)1-2-8(11(10)13)14-4-7(16)5-15/h1-2,7,14-16H,3-5H2,(H,17,18) |
| InChIKey | OJMUOUMRWDZNSQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |