C10H11BrFNO4 — CID 168593535
3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid (PubChem CID 168593535) has the molecular formula C10H11BrFNO4 and a molecular weight of 308.10 g/mol. Its IUPAC name is 3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid.
| Compound Name | 3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 168593535 |
| Molecular Formula | C10H11BrFNO4 |
| Molecular Weight | 308.10 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid |
| SMILES | O=C(O)c1c(NCC(O)CO)ccc(Br)c1F |
| InChI | InChI=1S/C10H11BrFNO4/c11-6-1-2-7(13-3-5(15)4-14)8(9(6)12)10(16)17/h1-2,5,13-15H,3-4H2,(H,16,17) |
| InChIKey | QZVFEOCREWUNHB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.10 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |