3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid

C10H11BrFNO4 — CID 168593535

IUPAC3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid
SMILESO=C(O)c1c(NCC(O)CO)ccc(Br)c1F
InChIInChI=1S/C10H11BrFNO4/c11-6-1-2-7(13-3-5(15)4-14)8(9(6)12)10(16)17/h1-2,5,13-15H,3-4H2,(H,16,17)
InChIKeyQZVFEOCREWUNHB-UHFFFAOYSA-N
MW308.10 g/mol
LogP1.05
Rot. Bonds5

About 3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid

3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid (PubChem CID 168593535) has the molecular formula C10H11BrFNO4 and a molecular weight of 308.10 g/mol. Its IUPAC name is 3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid.

Molecular Properties

Compound Name3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid
PubChem CID168593535
Molecular FormulaC10H11BrFNO4
Molecular Weight308.10 g/mol
Exact Mass306.99
IUPAC Name3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid
SMILESO=C(O)c1c(NCC(O)CO)ccc(Br)c1F
InChIInChI=1S/C10H11BrFNO4/c11-6-1-2-7(13-3-5(15)4-14)8(9(6)12)10(16)17/h1-2,5,13-15H,3-4H2,(H,16,17)
InChIKeyQZVFEOCREWUNHB-UHFFFAOYSA-N
XLogP1.05
TPSA89.79 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.10
LogP ≤ 51.05
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid?
The IUPAC name of 3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid (CID 168593535) is 3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid.
What is the SMILES notation for 3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid?
The canonical SMILES for 3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid is O=C(O)c1c(NCC(O)CO)ccc(Br)c1F.
What is the InChIKey of 3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid?
The InChIKey is QZVFEOCREWUNHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrFNO4/c11-6-1-2-7(13-3-5(15)4-14)8(9(6)12)10(16)17/h1-2,5,13-15H,3-4H2,(H,16,17).
What are the key properties of 3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid?
3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid has a molecular weight of 308.10 g/mol, XLogP of 1.05, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-(2,3-dihydroxypropylamino)-2-fluorobenzoic acid is sourced from PubChem (CID 168593535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).