C10H13FN2O3 — CID 168593553
2-(2,3-dihydroxypropylamino)-6-fluorobenzamide (PubChem CID 168593553) has the molecular formula C10H13FN2O3 and a molecular weight of 228.22 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)-6-fluorobenzamide.
| Compound Name | 2-(2,3-dihydroxypropylamino)-6-fluorobenzamide |
|---|---|
| PubChem CID | 168593553 |
| Molecular Formula | C10H13FN2O3 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)-6-fluorobenzamide |
| SMILES | NC(=O)c1c(F)cccc1NCC(O)CO |
| InChI | InChI=1S/C10H13FN2O3/c11-7-2-1-3-8(9(7)10(12)16)13-4-6(15)5-14/h1-3,6,13-15H,4-5H2,(H2,12,16) |
| InChIKey | JIBHSSSXGAMMSG-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |