C11H16FN3O2 — CID 79521990
2-[(2-amino-3-hydroxybutyl)amino]-6-fluorobenzamide (PubChem CID 79521990) has the molecular formula C11H16FN3O2 and a molecular weight of 241.27 g/mol. Its IUPAC name is 2-[(2-amino-3-hydroxybutyl)amino]-6-fluorobenzamide.
| Compound Name | 2-[(2-amino-3-hydroxybutyl)amino]-6-fluorobenzamide |
|---|---|
| PubChem CID | 79521990 |
| Molecular Formula | C11H16FN3O2 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-[(2-amino-3-hydroxybutyl)amino]-6-fluorobenzamide |
| SMILES | CC(O)C(N)CNc1cccc(F)c1C(N)=O |
| InChI | InChI=1S/C11H16FN3O2/c1-6(16)8(13)5-15-9-4-2-3-7(12)10(9)11(14)17/h2-4,6,8,15-16H,5,13H2,1H3,(H2,14,17) |
| InChIKey | LQGXIZHCXUMREX-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |