C14H19F2NO2Si — CID 168594579
3-[2,3-difluoro-4-(2-trimethylsilylethynyl)anilino]propane-1,2-diol (PubChem CID 168594579) has the molecular formula C14H19F2NO2Si and a molecular weight of 299.39 g/mol. Its IUPAC name is 3-[2,3-difluoro-4-(2-trimethylsilylethynyl)anilino]propane-1,2-diol.
| Compound Name | 3-[2,3-difluoro-4-(2-trimethylsilylethynyl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168594579 |
| Molecular Formula | C14H19F2NO2Si |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-[2,3-difluoro-4-(2-trimethylsilylethynyl)anilino]propane-1,2-diol |
| SMILES | C[Si](C)(C)C#Cc1ccc(NCC(O)CO)c(F)c1F |
| InChI | InChI=1S/C14H19F2NO2Si/c1-20(2,3)7-6-10-4-5-12(14(16)13(10)15)17-8-11(19)9-18/h4-5,11,17-19H,8-9H2,1-3H3 |
| InChIKey | RUPMLRGFXUHWQL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|