C15H14F2N6Si — CID 169346111
3-[2,3-difluoro-4-(2-trimethylsilylethynyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346111) has the molecular formula C15H14F2N6Si and a molecular weight of 344.40 g/mol. Its IUPAC name is 3-[2,3-difluoro-4-(2-trimethylsilylethynyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2,3-difluoro-4-(2-trimethylsilylethynyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346111 |
| Molecular Formula | C15H14F2N6Si |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 3-[2,3-difluoro-4-(2-trimethylsilylethynyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | C[Si](C)(C)C#Cc1ccc(NC=C(C#N)c2nn[nH]n2)c(F)c1F |
| InChI | InChI=1S/C15H14F2N6Si/c1-24(2,3)7-6-10-4-5-12(14(17)13(10)16)19-9-11(8-18)15-20-22-23-21-15/h4-5,9,19H,1-3H3,(H,20,21,22,23) |
| InChIKey | FOYIXGQZYVLJDS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|