C14H15FN6O — CID 172979643
(1Z)-2-amino-N-[3-fluoro-4-(pyrrolidine-1-carbonyl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172979643) has the molecular formula C14H15FN6O and a molecular weight of 302.31 g/mol. Its IUPAC name is (1Z)-2-amino-N-[3-fluoro-4-(pyrrolidine-1-carbonyl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[3-fluoro-4-(pyrrolidine-1-carbonyl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172979643 |
| Molecular Formula | C14H15FN6O |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (1Z)-2-amino-N-[3-fluoro-4-(pyrrolidine-1-carbonyl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(C(=O)N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C14H15FN6O/c15-11-7-9(19-20-12(8-16)13(17)18)3-4-10(11)14(22)21-5-1-2-6-21/h3-4,7,19H,1-2,5-6H2,(H3,17,18)/b20-12+ |
| InChIKey | IQZLZZWLGDHUMW-UDWIEESQSA-N |
| XLogP | 1.29 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|