C17H24N6O3 — CID 172980151
(1Z)-2-amino-N-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172980151) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is (1Z)-2-amino-N-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172980151 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (1Z)-2-amino-N-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(OCC)c(N2CCOCC2)cc1OCC |
| InChI | InChI=1S/C17H24N6O3/c1-3-25-15-10-14(23-5-7-24-8-6-23)16(26-4-2)9-12(15)21-22-13(11-18)17(19)20/h9-10,21H,3-8H2,1-2H3,(H3,19,20)/b22-13+ |
| InChIKey | LMXUAKDIALDUPC-LPYMAVHISA-N |
| XLogP | 1.55 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|