C15H18N6O3 — CID 172976707
(1Z)-2-amino-2-imino-N-[3-(2-morpholin-4-yl-2-oxoethoxy)anilino]ethanimidoyl cyanide (PubChem CID 172976707) has the molecular formula C15H18N6O3 and a molecular weight of 330.35 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-[3-(2-morpholin-4-yl-2-oxoethoxy)anilino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-[3-(2-morpholin-4-yl-2-oxoethoxy)anilino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172976707 |
| Molecular Formula | C15H18N6O3 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-[3-(2-morpholin-4-yl-2-oxoethoxy)anilino]ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cccc(OCC(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H18N6O3/c16-9-13(15(17)18)20-19-11-2-1-3-12(8-11)24-10-14(22)21-4-6-23-7-5-21/h1-3,8,19H,4-7,10H2,(H3,17,18)/b20-13+ |
| InChIKey | SQJSGADMEAMANM-DEDYPNTBSA-N |
| XLogP | 0.15 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|