C14H11N7O3 — CID 172979376
(1Z)-2-amino-2-imino-N-[3-[(3-nitro-2-pyridinyl)oxy]anilino]ethanimidoyl cyanide (PubChem CID 172979376) has the molecular formula C14H11N7O3 and a molecular weight of 325.29 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-[3-[(3-nitro-2-pyridinyl)oxy]anilino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-[3-[(3-nitro-2-pyridinyl)oxy]anilino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172979376 |
| Molecular Formula | C14H11N7O3 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-[3-[(3-nitro-2-pyridinyl)oxy]anilino]ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cccc(Oc2ncccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H11N7O3/c15-8-11(13(16)17)20-19-9-3-1-4-10(7-9)24-14-12(21(22)23)5-2-6-18-14/h1-7,19H,(H3,16,17)/b20-11+ |
| InChIKey | RYRXOGCEGHRQIZ-RGVLZGJSSA-N |
| XLogP | 2.01 |
| TPSA | 163.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|