C16H15N5O4 — CID 172978230
5-[[2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-4-methylphenoxy]methyl]furan-2-carboxylic acid (PubChem CID 172978230) has the molecular formula C16H15N5O4 and a molecular weight of 341.33 g/mol. Its IUPAC name is 5-[[2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-4-methylphenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-4-methylphenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 172978230 |
| Molecular Formula | C16H15N5O4 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 5-[[2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-4-methylphenoxy]methyl]furan-2-carboxylic acid |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(C)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C16H15N5O4/c1-9-2-4-13(11(6-9)20-21-12(7-17)15(18)19)24-8-10-3-5-14(25-10)16(22)23/h2-6,20H,8H2,1H3,(H3,18,19)(H,22,23)/b21-12+ |
| InChIKey | HVSJEWDEZQYZAS-CIAFOILYSA-N |
| XLogP | 2.09 |
| TPSA | 157.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|