C10H9F2N5O — CID 172977132
(1Z)-2-amino-N-(2,6-difluoro-3-methoxyanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172977132) has the molecular formula C10H9F2N5O and a molecular weight of 253.21 g/mol. Its IUPAC name is (1Z)-2-amino-N-(2,6-difluoro-3-methoxyanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(2,6-difluoro-3-methoxyanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172977132 |
| Molecular Formula | C10H9F2N5O |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | (1Z)-2-amino-N-(2,6-difluoro-3-methoxyanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(F)ccc(OC)c1F |
| InChI | InChI=1S/C10H9F2N5O/c1-18-7-3-2-5(11)9(8(7)12)17-16-6(4-13)10(14)15/h2-3,17H,1H3,(H3,14,15)/b16-6+ |
| InChIKey | BUULXWVESINEMG-OMCISZLKSA-N |
| XLogP | 1.20 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|