C11H10FN5O2 — CID 172977426
2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-6-fluoro-4-methylbenzoic acid (PubChem CID 172977426) has the molecular formula C11H10FN5O2 and a molecular weight of 263.23 g/mol. Its IUPAC name is 2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-6-fluoro-4-methylbenzoic acid.
| Compound Name | 2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-6-fluoro-4-methylbenzoic acid |
|---|---|
| PubChem CID | 172977426 |
| Molecular Formula | C11H10FN5O2 |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-6-fluoro-4-methylbenzoic acid |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(C)cc(F)c1C(=O)O |
| InChI | InChI=1S/C11H10FN5O2/c1-5-2-6(12)9(11(18)19)7(3-5)16-17-8(4-13)10(14)15/h2-3,16H,1H3,(H3,14,15)(H,18,19)/b17-8+ |
| InChIKey | LETIDNABWYLNPR-CAOOACKPSA-N |
| XLogP | 1.06 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|