C16H12N6O3 — CID 172980011
(1Z)-2-amino-N-(4-benzoyl-2-nitroanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172980011) has the molecular formula C16H12N6O3 and a molecular weight of 336.31 g/mol. Its IUPAC name is (1Z)-2-amino-N-(4-benzoyl-2-nitroanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(4-benzoyl-2-nitroanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172980011 |
| Molecular Formula | C16H12N6O3 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (1Z)-2-amino-N-(4-benzoyl-2-nitroanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(C(=O)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12N6O3/c17-9-13(16(18)19)21-20-12-7-6-11(8-14(12)22(24)25)15(23)10-4-2-1-3-5-10/h1-8,20H,(H3,18,19)/b21-13+ |
| InChIKey | VRKFKQBVRNDUPF-FYJGNVAPSA-N |
| XLogP | 2.05 |
| TPSA | 158.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|