C17H25N5O — CID 172976307
(1Z)-2-amino-2-imino-N-(4-octoxyanilino)ethanimidoyl cyanide (PubChem CID 172976307) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-(4-octoxyanilino)ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-(4-octoxyanilino)ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172976307 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-(4-octoxyanilino)ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(OCCCCCCCC)cc1 |
| InChI | InChI=1S/C17H25N5O/c1-2-3-4-5-6-7-12-23-15-10-8-14(9-11-15)21-22-16(13-18)17(19)20/h8-11,21H,2-7,12H2,1H3,(H3,19,20)/b22-16+ |
| InChIKey | QLJNTZLCIYEBDB-CJLVFECKSA-N |
| XLogP | 3.65 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|