C19H22N4O — CID 168606751
2-(4-octoxyanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168606751) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-(4-octoxyanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(4-octoxyanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168606751 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-(4-octoxyanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | CCCCCCCCOc1ccc(NC(C#N)=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C19H22N4O/c1-2-3-4-5-6-7-12-24-18-10-8-17(9-11-18)23-19(15-22)16(13-20)14-21/h8-11,23H,2-7,12H2,1H3 |
| InChIKey | ZNJSCZJZFMYHBA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|