C14H15N7O — CID 172978269
(1Z)-2-amino-2-imino-N-[4-[(2-methylpyrazol-3-yl)methoxy]anilino]ethanimidoyl cyanide (PubChem CID 172978269) has the molecular formula C14H15N7O and a molecular weight of 297.32 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-[4-[(2-methylpyrazol-3-yl)methoxy]anilino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-[4-[(2-methylpyrazol-3-yl)methoxy]anilino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978269 |
| Molecular Formula | C14H15N7O |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-[4-[(2-methylpyrazol-3-yl)methoxy]anilino]ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(OCc2ccnn2C)cc1 |
| InChI | InChI=1S/C14H15N7O/c1-21-11(6-7-18-21)9-22-12-4-2-10(3-5-12)19-20-13(8-15)14(16)17/h2-7,19H,9H2,1H3,(H3,16,17)/b20-13+ |
| InChIKey | HOBSVYXNBNSNFG-DEDYPNTBSA-N |
| XLogP | 1.23 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|