C13H14N6O — CID 172977887
(1Z)-2-amino-N-[(3,3-dimethyl-2-oxo-1H-indol-5-yl)amino]-2-iminoethanimidoyl cyanide (PubChem CID 172977887) has the molecular formula C13H14N6O and a molecular weight of 270.30 g/mol. Its IUPAC name is (1Z)-2-amino-N-[(3,3-dimethyl-2-oxo-1H-indol-5-yl)amino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[(3,3-dimethyl-2-oxo-1H-indol-5-yl)amino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172977887 |
| Molecular Formula | C13H14N6O |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (1Z)-2-amino-N-[(3,3-dimethyl-2-oxo-1H-indol-5-yl)amino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc2c(c1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C13H14N6O/c1-13(2)8-5-7(3-4-9(8)17-12(13)20)18-19-10(6-14)11(15)16/h3-5,18H,1-2H3,(H3,15,16)(H,17,20)/b19-10+ |
| InChIKey | PZAPMPVQNGJQLH-VXLYETTFSA-N |
| XLogP | 1.14 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|