C12H9ClN6O — CID 172979437
(1Z)-2-amino-N-[(4-chloro-1-oxo-2H-isoquinolin-7-yl)amino]-2-iminoethanimidoyl cyanide (PubChem CID 172979437) has the molecular formula C12H9ClN6O and a molecular weight of 288.70 g/mol. Its IUPAC name is (1Z)-2-amino-N-[(4-chloro-1-oxo-2H-isoquinolin-7-yl)amino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[(4-chloro-1-oxo-2H-isoquinolin-7-yl)amino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172979437 |
| Molecular Formula | C12H9ClN6O |
| Molecular Weight | 288.70 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | (1Z)-2-amino-N-[(4-chloro-1-oxo-2H-isoquinolin-7-yl)amino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc2c(Cl)c[nH]c(=O)c2c1 |
| InChI | InChI=1S/C12H9ClN6O/c13-9-5-17-12(20)8-3-6(1-2-7(8)9)18-19-10(4-14)11(15)16/h1-3,5,18H,(H3,15,16)(H,17,20)/b19-10+ |
| InChIKey | YOILPHQEVILUJF-VXLYETTFSA-N |
| XLogP | 1.41 |
| TPSA | 130.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.70 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|