C14H17FN6O2 — CID 172977703
tert-butyl N-[5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-2-fluorophenyl]carbamate (PubChem CID 172977703) has the molecular formula C14H17FN6O2 and a molecular weight of 320.33 g/mol. Its IUPAC name is tert-butyl N-[5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-2-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 172977703 |
| Molecular Formula | C14H17FN6O2 |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | tert-butyl N-[5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-2-fluorophenyl]carbamate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(F)c(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C14H17FN6O2/c1-14(2,3)23-13(22)19-10-6-8(4-5-9(10)15)20-21-11(7-16)12(17)18/h4-6,20H,1-3H3,(H3,17,18)(H,19,22)/b21-11+ |
| InChIKey | NFSDJKJFBXGTCV-SRZZPIQSSA-N |
| XLogP | 2.40 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|