C19H26N6O4 — CID 172979316
ethyl 3-[4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 172979316) has the molecular formula C19H26N6O4 and a molecular weight of 402.46 g/mol. Its IUPAC name is ethyl 3-[4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | ethyl 3-[4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 172979316 |
| Molecular Formula | C19H26N6O4 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | ethyl 3-[4-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(CC(NC(=O)OC(C)(C)C)C(=O)OCC)cc1 |
| InChI | InChI=1S/C19H26N6O4/c1-5-28-17(26)14(23-18(27)29-19(2,3)4)10-12-6-8-13(9-7-12)24-25-15(11-20)16(21)22/h6-9,14,24H,5,10H2,1-4H3,(H3,21,22)(H,23,27)/b25-15+ |
| InChIKey | CFDXUNRMVVCOGT-MFKUBSTISA-N |
| XLogP | 1.91 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|