C15H14N6O2 — CID 169341046
tert-butyl 5-[2-(dicyanomethylidene)hydrazinyl]benzimidazole-1-carboxylate (PubChem CID 169341046) has the molecular formula C15H14N6O2 and a molecular weight of 310.32 g/mol. Its IUPAC name is tert-butyl 5-[2-(dicyanomethylidene)hydrazinyl]benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 5-[2-(dicyanomethylidene)hydrazinyl]benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 169341046 |
| Molecular Formula | C15H14N6O2 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | tert-butyl 5-[2-(dicyanomethylidene)hydrazinyl]benzimidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cnc2cc(NN=C(C#N)C#N)ccc21 |
| InChI | InChI=1S/C15H14N6O2/c1-15(2,3)23-14(22)21-9-18-12-6-10(4-5-13(12)21)19-20-11(7-16)8-17/h4-6,9,19H,1-3H3 |
| InChIKey | XLEPUSQRIXRPGM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|