C24H23F4N3O5 — CID 138503610
tert-butyl 5-[[3-[4-(2,2-difluoropropoxy)-2,6-difluorophenyl]-3-oxopropanoyl]amino]benzimidazole-1-carboxylate (PubChem CID 138503610) has the molecular formula C24H23F4N3O5 and a molecular weight of 509.46 g/mol. Its IUPAC name is tert-butyl 5-[[3-[4-(2,2-difluoropropoxy)-2,6-difluorophenyl]-3-oxopropanoyl]amino]benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 5-[[3-[4-(2,2-difluoropropoxy)-2,6-difluorophenyl]-3-oxopropanoyl]amino]benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 138503610 |
| Molecular Formula | C24H23F4N3O5 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | tert-butyl 5-[[3-[4-(2,2-difluoropropoxy)-2,6-difluorophenyl]-3-oxopropanoyl]amino]benzimidazole-1-carboxylate |
| SMILES | CC(F)(F)COc1cc(F)c(C(=O)CC(=O)Nc2ccc3c(c2)ncn3C(=O)OC(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C24H23F4N3O5/c1-23(2,3)36-22(34)31-12-29-17-7-13(5-6-18(17)31)30-20(33)10-19(32)21-15(25)8-14(9-16(21)26)35-11-24(4,27)28/h5-9,12H,10-11H2,1-4H3,(H,30,33) |
| InChIKey | OLRJZJLIXIGNDZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|