C14H14BrFN2O3 — CID 59283408
tert-butyl 6-(bromomethyl)-7-fluoro-4-oxoquinazoline-3-carboxylate (PubChem CID 59283408) has the molecular formula C14H14BrFN2O3 and a molecular weight of 357.18 g/mol. Its IUPAC name is tert-butyl 6-(bromomethyl)-7-fluoro-4-oxoquinazoline-3-carboxylate.
| Compound Name | tert-butyl 6-(bromomethyl)-7-fluoro-4-oxoquinazoline-3-carboxylate |
|---|---|
| PubChem CID | 59283408 |
| Molecular Formula | C14H14BrFN2O3 |
| Molecular Weight | 357.18 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | tert-butyl 6-(bromomethyl)-7-fluoro-4-oxoquinazoline-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cnc2cc(F)c(CBr)cc2c1=O |
| InChI | InChI=1S/C14H14BrFN2O3/c1-14(2,3)21-13(20)18-7-17-11-5-10(16)8(6-15)4-9(11)12(18)19/h4-5,7H,6H2,1-3H3 |
| InChIKey | YPRVFHDOHKWRNL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.18 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|