C13H14BrFN2O3 — CID 147126599
tert-butyl 5-(bromomethyl)-6-fluoro-3-oxo-1H-indazole-2-carboxylate (PubChem CID 147126599) has the molecular formula C13H14BrFN2O3 and a molecular weight of 345.17 g/mol. Its IUPAC name is tert-butyl 5-(bromomethyl)-6-fluoro-3-oxo-1H-indazole-2-carboxylate.
| Compound Name | tert-butyl 5-(bromomethyl)-6-fluoro-3-oxo-1H-indazole-2-carboxylate |
|---|---|
| PubChem CID | 147126599 |
| Molecular Formula | C13H14BrFN2O3 |
| Molecular Weight | 345.17 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | tert-butyl 5-(bromomethyl)-6-fluoro-3-oxo-1H-indazole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1[nH]c2cc(F)c(CBr)cc2c1=O |
| InChI | InChI=1S/C13H14BrFN2O3/c1-13(2,3)20-12(19)17-11(18)8-4-7(6-14)9(15)5-10(8)16-17/h4-5,16H,6H2,1-3H3 |
| InChIKey | BPKAGKDHSNFDMA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.17 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|