C16H21FN4O2S — CID 22272977
tert-butyl 4-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)piperazine-1-carboxylate (PubChem CID 22272977) has the molecular formula C16H21FN4O2S and a molecular weight of 352.44 g/mol. Its IUPAC name is tert-butyl 4-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22272977 |
| Molecular Formula | C16H21FN4O2S |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | tert-butyl 4-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc3[nH]c(=S)[nH]c3cc2F)CC1 |
| InChI | InChI=1S/C16H21FN4O2S/c1-16(2,3)23-15(22)21-6-4-20(5-7-21)13-9-12-11(8-10(13)17)18-14(24)19-12/h8-9H,4-7H2,1-3H3,(H2,18,19,24) |
| InChIKey | LSINYKKUIDNSBN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|