C24H31BrFN3O7 — CID 59490948
tert-butyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(bromomethyl)-7-fluoro-4-oxoquinazoline-3-carboxylate (PubChem CID 59490948) has the molecular formula C24H31BrFN3O7 and a molecular weight of 572.43 g/mol. Its IUPAC name is tert-butyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(bromomethyl)-7-fluoro-4-oxoquinazoline-3-carboxylate.
| Compound Name | tert-butyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(bromomethyl)-7-fluoro-4-oxoquinazoline-3-carboxylate |
|---|---|
| PubChem CID | 59490948 |
| Molecular Formula | C24H31BrFN3O7 |
| Molecular Weight | 572.43 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | tert-butyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(bromomethyl)-7-fluoro-4-oxoquinazoline-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1nc2cc(F)c(CBr)cc2c(=O)n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31BrFN3O7/c1-22(2,3)34-19(31)28-17(30)14-10-13(12-25)15(26)11-16(14)27-18(28)29(20(32)35-23(4,5)6)21(33)36-24(7,8)9/h10-11H,12H2,1-9H3 |
| InChIKey | DRJLWUFVKSIQGV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 117.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.43 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|