C16H21N3O4 — CID 58936220
tert-butyl 3-oxo-6-(3-oxobutylamino)-2H-indazole-1-carboxylate (PubChem CID 58936220) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is tert-butyl 3-oxo-6-(3-oxobutylamino)-2H-indazole-1-carboxylate.
| Compound Name | tert-butyl 3-oxo-6-(3-oxobutylamino)-2H-indazole-1-carboxylate |
|---|---|
| PubChem CID | 58936220 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | tert-butyl 3-oxo-6-(3-oxobutylamino)-2H-indazole-1-carboxylate |
| SMILES | CC(=O)CCNc1ccc2c(=O)[nH]n(C(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C16H21N3O4/c1-10(20)7-8-17-11-5-6-12-13(9-11)19(18-14(12)21)15(22)23-16(2,3)4/h5-6,9,17H,7-8H2,1-4H3,(H,18,21) |
| InChIKey | WFHYQOMNEJGUCC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |