C21H29N3O3 — CID 87629913
tert-butyl 4-[3-(5-formylbenzimidazol-1-yl)propyl]piperidine-1-carboxylate (PubChem CID 87629913) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is tert-butyl 4-[3-(5-formylbenzimidazol-1-yl)propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(5-formylbenzimidazol-1-yl)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87629913 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | tert-butyl 4-[3-(5-formylbenzimidazol-1-yl)propyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCn2cnc3cc(C=O)ccc32)CC1 |
| InChI | InChI=1S/C21H29N3O3/c1-21(2,3)27-20(26)23-11-8-16(9-12-23)5-4-10-24-15-22-18-13-17(14-25)6-7-19(18)24/h6-7,13-16H,4-5,8-12H2,1-3H3 |
| InChIKey | QDFQVQZCNRBEPT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|