C19H28N4O6 — CID 22343189
tert-butyl 4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-cyanoimidazole-1-carboxylate (PubChem CID 22343189) has the molecular formula C19H28N4O6 and a molecular weight of 408.46 g/mol. Its IUPAC name is tert-butyl 4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-cyanoimidazole-1-carboxylate.
| Compound Name | tert-butyl 4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-cyanoimidazole-1-carboxylate |
|---|---|
| PubChem CID | 22343189 |
| Molecular Formula | C19H28N4O6 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | tert-butyl 4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-cyanoimidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1ncn(C(=O)OC(C)(C)C)c1C#N |
| InChI | InChI=1S/C19H28N4O6/c1-17(2,3)27-14(24)22-11-21-13(12(22)10-20)23(15(25)28-18(4,5)6)16(26)29-19(7,8)9/h11H,1-9H3 |
| InChIKey | ZOYXTDGZFDCRNS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 123.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|