C15H23N3O6 — CID 151804116
3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-1-methylpyrazole-4-carboxylic acid (PubChem CID 151804116) has the molecular formula C15H23N3O6 and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 151804116 |
| Molecular Formula | C15H23N3O6 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-1-methylpyrazole-4-carboxylic acid |
| SMILES | Cn1cc(C(=O)O)c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C15H23N3O6/c1-14(2,3)23-12(21)18(13(22)24-15(4,5)6)10-9(11(19)20)8-17(7)16-10/h8H,1-7H3,(H,19,20) |
| InChIKey | RZFUHTHRXZSIJY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |